| Catalog Number |
ACM343338318 |
| CAS |
343338-31-8 |
| Synonyms |
[2H7]-(2E)-3-Phenyl-2-propenoic acid |
| IUPAC Name |
2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid |
| Molecular Weight |
155.20 |
| Molecular Formula |
C9HD7O2 |
| InChI |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/i1D,2D,3D,4D,5D,6D,7D |
| InChI Key |
WBYWAXJHAXSJNI-GSNKEKJESA-N |
| Chemical Formula |
C6D5CD=CDCOOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C(=C([2H])C(=O)O)[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
140-10-3 |
| Unlabeled Synonyms |
trans-3-Phenylacrylic acid |
