| Catalog Number |
ACM352431482-1 |
| CAS |
352431-48-2 |
| Structure |
 |
| Synonyms |
(2E)-3-(Phenyl-d5)-2-propenoic acid |
| IUPAC Name |
(E)-2,3-dideuterio-3-(2,3,4-trideuteriophenyl)prop-2-enoic acid |
| Molecular Weight |
153.19 |
| Molecular Formula |
C9H3D5O2 |
| InChI |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+/i1D,2D,4D,6D,7D |
| InChI Key |
WBYWAXJHAXSJNI-WEAFGLHZSA-N |
| Chemical Formula |
C6D5CH=CHCOOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C=C1)/C(=C(\[2H])/C(=O)O)/[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
140-10-3 |
| Unlabeled Synonyms |
trans-3-Phenylacrylic acid |
