| Catalog Number |
ACM1396967820 |
| CAS |
1396967-82-0 |
| Structure |
 |
| Synonyms |
AHTN (Tonalide) (6-Acetyl) D3 |
| IUPAC Name |
2,2,2-trideuterio-1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone |
| Molecular Weight |
261.41 |
| Molecular Formula |
C18H23D3O |
| InChI |
InChI=1S/C18H26O/c1-11-8-16-15(9-14(11)13(3)19)17(4,5)10-12(2)18(16,6)7/h8-9,12H,10H2,1-7H3/i3D3 |
| InChI Key |
DNRJTBAOUJJKDY-HPRDVNIFSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)C1=CC2=C(C=C1C)C(C(CC2(C)C)C)(C)C |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
21145-77-7 |
| Unlabeled Synonyms |
6-Acetyl-1,1,2,4,4,7-hexamethyltetralin |
