| Catalog Number |
ACM200417681-1 |
| CAS |
200417-68-1 |
| Structure |
 |
| Synonyms |
Thymine-13C1 |
| IUPAC Name |
5-methyl-(2-13C)1H-pyrimidine-2,4-dione |
| Molecular Weight |
127.12 |
| Molecular Formula |
13CC4H6N2O2 |
| InChI |
InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)/i5+1 |
| InChI Key |
RWQNBRDOKXIBIV-HOSYLAQJSA-N |
| Purity |
97% |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
CC1=CN[13C](=O)NC1=O |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
65-71-4 |
| Unlabeled Synonyms |
2,4-Dihydroxy-5-methylpyrimidine; 5-Methyluracil |
