Thymidine (Deoxyribose-5,5-D2)
| Catalog Number |
ACM132376922-1 |
| CAS |
132376-92-2 |
| Structure |
 |
| Synonyms |
[5',5''-2H2]Thymidine |
| IUPAC Name |
1-[(2R,4S,5R)-5-[dideuterio(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| Molecular Weight |
244.24 |
| Molecular Formula |
C10H12D2N2O5 |
| InChI |
InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i4D2 |
| InChI Key |
IQFYYKKMVGJFEH-PQDUBQKDSA-N |
| Melting Point |
186-188 °C (367-370 °F) |
| Purity |
98% |
| Solubility |
Soluble in water |
| Appearance |
White powder |
| Isomeric SMILES |
[2H]C([2H])([C@@H]1[C@H](C[C@@H](O1)N2C=C(C(=O)NC2=O)C)O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
50-89-5 |
| Unlabeled Synonyms |
dT; Thymine deoxyriboside; 1-(2-Deoxy-β-D-ribofuranosyl)thymine; 1-(2-Deoxy-β-Dribofuranosyl)-5-methyluracil; 2'-Deoxythymidine |
Please kindly note that our products and services are for research use only.
