| Catalog Number |
ACM132376922-2 |
| CAS |
132376-92-2 |
| Structure |
 |
| Description |
Thymidine-5',5''-D2 is a stable isotope that can be used to trace the fate of thymidine in vivo, as it is metabolized in the body. |
| Synonyms |
[5',5''-2H2]thymidine; thymidine-5',5'-d2 |
| IUPAC Name |
1-[(2R,4S,5R)-5-[dideuterio(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| Molecular Weight |
244.24 |
| Molecular Formula |
C10D2H12N2O5 |
| Canonical SMILES |
CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O |
| InChI |
1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i4D2 |
| InChI Key |
IQFYYKKMVGJFEH-PQDUBQKDSA-N |
| Melting Point |
185-187 °C |
| Solubility |
Soluble in water and methanol |
| Storage |
Keep container closed when no tin use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances |
| Stability |
It is stable under normal conditions and does not decompose easily. |
| Type |
Nucleic Acids - 13C, 15N Alphabetical Listing |
