| Catalog Number |
ACMA00051242 |
| Structure |
 |
| Description |
Thymidine (15N2) is a pyrimidine deoxynucleoside with thymine serving as its nucleobase. It is a building block for DNA nucleotides and plays an essential role in cell biology by synchronizing the cells during S-phase. It can be used as an isotopically labeled precursor. |
| Synonyms |
DThyd-15N2; NSC-15N2 |
| Molecular Weight |
244.22 |
| Molecular Formula |
C10H1415N2O5 |
| Canonical SMILES |
O=C1[15N](C=C(C([15NH]1)=O)C)[C@]2([H])O[C@@H]([C@H](C2)O)CO |
| Purity |
>97% |
| Appearance |
White to off-white solid |
| Application |
Biomolecular NMR, Genetic Therapy |
| Storage |
Store at room temperature away from light and moisture. |
| EC Number |
200-070-4 (Unlabeled) |
| Isotopic Enrichment |
98% 15N |
| Type |
Nucleotides and Nucleosides Alphabetic Listing |
| Unlabeled CAS |
50-89-5 |
