Thiouric Acid-13C3 Sodium Salt Dihydrate
| Catalog Number |
ACM1330823169 |
| CAS |
1330823-16-9 |
| Structure |
 |
| IUPAC Name |
(2,8-dihydroxy-9H-purin-6-yl)sulfanylsodium |
| Molecular Weight |
209.136 |
| Molecular Formula |
13C3C2H3N4NaO2S |
| Canonical SMILES |
O[13c]1n[13c]2[13c](S[Na])nc(O)nc2[nH]1 |
| InChI |
InChI=1S/C5H4N4O2S.Na/c10-4-6-1-2(7-4)8-5(11)9-3(1)12;/h(H4,6,7,8,9,10,11,12);/q;+1/p-1/i1+1,3+1,4+1; |
| Storage |
+4 °C |
| Accurate Mass |
208.998 |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Carbon |
Please kindly note that our products and services are for research use only.
