| Catalog Number |
ACM2036397-1 |
| CAS |
2036-39-7 |
| Structure |
 |
| Synonyms |
Thiophene-2,3,4,5-d4 (ACI), Thiophene-d4 (6CI, 7CI, 8CI, 9CI), 2,3,4,5-Tetradeuteriothiophene, Perdeuteriothiophene |
| IUPAC Name |
2,3,4,5-tetradeuteriothiophene |
| Molecular Weight |
88.16 |
| Molecular Formula |
C4D4S |
| Canonical SMILES |
[2H]c1sc([2H])c([2H])c1[2H] |
| InChI |
InChI=1S/C4H4S/c1-2-4-5-3-1/h1-4H/i1D,2D,3D,4D |
| Purity |
98 atom % D |
| Accurate Mass |
88.0285 |
| Format |
Neat |
| Functional Group |
Heterocycles,Sulfur Containing Compounds |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
FLAMMABLE LIQUID |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
110-02-1 |
