| Catalog Number |
ACM60658415 |
| CAS |
60658-41-5 |
| Structure |
 |
| Synonyms |
Myristic acid-D27 |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoic acid |
| Molecular Weight |
255.54 |
| Molecular Formula |
C14HD27O2 |
| InChI |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2 |
| InChI Key |
TUNFSRHWOTWDNC-RZVOLPTOSA-N |
| Boiling Point |
250 °C at 100 mmHg (lit.) |
| Melting Point |
52-54 °C (lit.) |
| Flash Point |
>230 °F (lit.) |
| Purity |
98 atom % D |
| Appearance |
Neat |
| Chemical Formula |
CD3(CD2)12COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
544-63-8 |
| Unlabeled Synonyms |
Myristic acid |
