Catalog Number |
ACM30719212 |
CAS |
30719-21-2 |
Structure |
|
Synonyms |
2,2-Dideuteriotetradecanoic acid |
IUPAC Name |
2,2-dideuteriotetradecanoic acid |
Molecular Weight |
230.39 |
Molecular Formula |
C14H26D2O2 |
InChI |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i13D2 |
InChI Key |
TUNFSRHWOTWDNC-KLTYLHELSA-N |
Purity |
98 atom % D |
Chemical Formula |
CH3(CH2)11CD2COOH |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCC)C(=O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
544-63-8 |
Unlabeled Synonyms |
Myristic acid |