Tetradecanoic-14,14,14-d3 acid
| Catalog Number |
ACM62217714 |
| CAS |
62217-71-4 |
| Structure |
 |
| Synonyms |
Tetradecanoic acid(D3) |
| IUPAC Name |
14,14,14-trideuteriotetradecanoic acid |
| Molecular Weight |
231.39 |
| Molecular Formula |
C14H25D3O2 |
| InChI |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3 |
| InChI Key |
TUNFSRHWOTWDNC-FIBGUPNXSA-N |
| Boiling Point |
250 °C at 100 mmHg (lit.) |
| Melting Point |
52-54 °C (lit.) |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)12COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
544-63-8 |
| Unlabeled Synonyms |
Myristic acid |
Please kindly note that our products and services are for research use only.
