| Catalog Number |
ACM327077032 |
| CAS |
327077-03-2 |
| Structure |
 |
| Synonyms |
Myristic acid-13,13,14,14,14-[D5] |
| IUPAC Name |
13,13,14,14,14-pentadeuteriotetradecanoic acid |
| Molecular Weight |
233.40 |
| Molecular Formula |
C14H23D5O2 |
| InChI |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3,2D2 |
| InChI Key |
TUNFSRHWOTWDNC-ZBJDZAJPSA-N |
| Boiling Point |
250 °C at 100 mmHg (lit.) |
| Melting Point |
52-54 °C (lit.) |
| Chemical Formula |
CD3CD2(CH2)11COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])CCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
544-63-8 |
| Unlabeled Synonyms |
Myristic acid |
