| Catalog Number |
ACM358730979 |
| CAS |
358730-97-9 |
| Structure |
 |
| Synonyms |
12-Deuteriotetradecanoic acid |
| IUPAC Name |
12-deuteriotetradecanoic acid |
| Molecular Weight |
229.38 |
| Molecular Formula |
C14H27DO2 |
| InChI |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i3D |
| InChI Key |
TUNFSRHWOTWDNC-WFVSFCRTSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CH3CH2CHD(CH2)10COOH |
| Exact Mass |
229.21500 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(CC)CCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
544-63-8 |
| Unlabeled Synonyms |
Myristic acid |
