| Catalog Number |
ACM203633129-1 |
| CAS |
203633-12-9 |
| Structure |
 |
| IUPAC Name |
1,1,1-trideuterio-2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| Molecular Weight |
157.27 |
| Molecular Formula |
C10H15D3O |
| InChI |
InChI=1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/t9-/m1/s1/i2D3/t9-,10? |
| InChI Key |
WUOACPNHFRMFPN-DPIUJBPVSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(C)([C@H]1CCC(=CC1)C)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
98-55-5 |
| Unlabeled Synonyms |
p-Menth-1-en-8-ol |
