| Catalog Number |
ACM77435462-1 |
| CAS |
77435-46-2 |
| Structure |
 |
| Description |
Sulfonamide-D4 is a deuterium-labeled sulfonamide. Sulfonamide is an organic compound with medicinal value. It is commonly used in the pharmaceutical industry and is the main raw material for the synthesis of sulfa drugs. |
| Synonyms |
Sulphanilamide-d4 |
| Molecular Weight |
176.23 |
| Molecular Formula |
C6H4D4N2O2S |
| Canonical SMILES |
NS(=O)(C1=C([2H])C([2H])=C(C([2H])=C1[2H])N)=O |
| Purity |
0.9999 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
