| Catalog Number |
ACM1330266051 |
| CAS |
1330266-05-1 |
| Structure |
 |
| Description |
Sulfadoxine-d4 is deuterium-labeled sulfadoxine. Sulfadoxine, also known as sulfamethazine, is used for bacterial infections such as hemolytic streptococci, pneumococci, and Shigella, and is now rarely used. This product combined with pyrimethamine can be used to prevent and treat malaria caused by chloroquine-resistant Plasmodium falciparum, and can also be used for the prevention of malaria. |
| Synonyms |
Sulphadoxine-d4 |
| Molecular Weight |
314.35 |
| Molecular Formula |
C12H10D4N4O4S |
| Canonical SMILES |
O=S(C1=C([2H])C([2H])=C(N)C([2H])=C1[2H])(NC2=NC=NC(OC)=C2OC)=O |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
