| Catalog Number |
ACM1020719781-1 |
| CAS |
1020719-78-1 |
| Structure |
 |
| Description |
Sulfadiazine-d4 is a deuterium labeled Sulfadiazine. Sulfadiazine can be used to treat systemic infections. It has a broad antibacterial spectrum and has inhibitory effects on most Gram-positive and negative bacteria. It has strong inhibitory effects on Neisseria meningitidis, Streptococcus pneumoniae, Neisseria gonorrhoeae, and hemolytic Streptococcus. Can penetrate into the cerebrospinal fluid through the blood-brain barrier. |
| Molecular Weight |
254.3 |
| Molecular Formula |
C10H6D4N4O2S |
| Canonical SMILES |
O=S(C1=C([2H])C([2H])=C(N)C([2H])=C1[2H])(NC2=NC=CC=N2)=O |
| Purity |
0.9812 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
