Sodium pyruvate (2,3-13C2)
| Catalog Number |
ACM89196781-1 |
| CAS |
89196-78-1 |
| Structure |
 |
| Synonyms |
Sodium pyruvate-2,3-13C2 |
| IUPAC Name |
sodium;2-oxo(2,3-13C2)propanoate |
| Molecular Weight |
112.03 |
| Molecular Formula |
13C2CH3NaO3 |
| InChI |
InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1/i1+1,2+1; |
| InChI Key |
DAEPDZWVDSPTHF-AWQJXPNKSA-M |
| Melting Point |
>300 °C (>572 °F) |
| Purity |
98% |
| Solubility |
Water: 100 % |
| Appearance |
White powder |
| Chemical Formula |
*CH3*C(O)COONa |
| Isomeric SMILES |
[13CH3][13C](=O)C(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C |
| pH |
7 |
| Stability |
One year after receipt. Re-QC after one year. |
| Unlabeled CAS |
113-24-6 |
| Unlabeled Synonyms |
α-Ketopropionic acid sodium salt; 2-Oxopropanoic acid sodium salt; Pyruvic acid dsodium salt |
Please kindly note that our products and services are for research use only.
