Sodium propionate (1-13C)
| Catalog Number |
ACM62601063-1 |
| CAS |
62601-06-3 |
| Structure |
 |
| Synonyms |
Sodium propionate-1-13C |
| IUPAC Name |
sodium;(1-13C)propanoate |
| Molecular Weight |
97.05 |
| Molecular Formula |
13CC2H5NaO2 |
| InChI |
InChI=1S/C3H6O2.Na/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1/i3+1; |
| InChI Key |
JXKPEJDQGNYQSM-FJUFCODESA-M |
| Melting Point |
285-286 °C (545-547 °F) (lit.) |
| Purity |
98% |
| Appearance |
White powder |
| Chemical Formula |
CH3CH2*COONa |
| Isomeric SMILES |
CC[13C](=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
137-40-6 |
| Unlabeled Synonyms |
Propionic acidsodium salt |
Please kindly note that our products and services are for research use only.
