| Catalog Number |
ACM56408903 |
| CAS |
56408-90-3 |
| Structure |
 |
| Synonyms |
Sodium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
| IUPAC Name |
sodium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
| Molecular Weight |
181.29 |
| Molecular Formula |
C8D15NaO2 |
| Canonical SMILES |
CCCCCCCC(=O)[O-].[Na+] |
| InChI |
InChI=1S/C8H16O2.Na/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2; |
| InChI Key |
BYKRNSHANADUFY-QBMKXHHWSA-M |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)6COONa |
| Exact Mass |
181.19112519 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
181.19112519 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
1984-06-1 |
| Unlabeled Synonyms |
Octanoic acid, sodium salt; Sodium caprylate |
