| Catalog Number |
ACM1219795013 |
| CAS |
1219795-01-3 |
| Synonyms |
Octanoic acid, sodium salt-8,8,8-D3 |
| IUPAC Name |
sodium;8,8,8-trideuteriooctanoate |
| Molecular Weight |
169.21 |
| Molecular Formula |
C8H14D3NaO2 |
| InChI |
InChI=1S/C8H16O2.Na/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1/i1D3; |
| InChI Key |
BYKRNSHANADUFY-NIIDSAIPSA-M |
| Chemical Formula |
CD3(CH2)6COONa |
| Exact Mass |
169.11580424 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCC(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % D |
| Monoisotopic Mass |
169.11580424 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
1984-06-1 |
| Unlabeled Synonyms |
Octanoic acid, sodium salt; Sodium caprylate |
