Catalog Number |
ACM110863246-1 |
CAS |
110863-24-6 |
Structure |
 |
Synonyms |
Sodium dodecyl sulfate-D25 |
IUPAC Name |
sodium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecyl sulfate |
Molecular Weight |
313.53 |
Molecular Formula |
C12D25NaO4S |
InChI |
InChI=1S/C12H26O4S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h2-12H2,1H3,(H,13,14,15);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2; |
InChI Key |
DBMJMQXJHONAFJ-YCGROXIYSA-M |
Melting Point |
204-207 °C (399-405 °F) (lit.) |
Flash Point |
170 °C (338 °F) |
Purity |
98% |
Density |
0.37 g/cm3 |
Appearance |
White solid |
Chemical Formula |
CD3(CD2)11OSO3Na |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OS(=O)(=O)[O-].[Na+] |
Isotopic Enrichment |
98 atom % D |
Odor |
Odourless |
pH |
9.1 at 10 g/L |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
151-21-3 |
Synonyms (Unlabeled) |
Sodium lauryl sulfate; Dodecyl sulfate sodium salt; SDS |