Sodium hexadecanoate-16,16,16-d3
| Catalog Number |
ACM347841376 |
| CAS |
347841-37-6 |
| Structure |
 |
| Synonyms |
Sodium;16,16,16-trideuteriohexadecanoate |
| IUPAC Name |
sodium;16,16,16-trideuteriohexadecanoate |
| Molecular Weight |
281.43 |
| Molecular Formula |
C16H28D3NaO2 |
| InChI |
InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i1D3; |
| InChI Key |
GGXKEBACDBNFAF-NIIDSAIPSA-M |
| Purity |
99 atom % D |
| Chemical Formula |
CD3(CH2)14COONa |
| Exact Mass |
281.24100475 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % D |
| Monoisotopic Mass |
281.24100475 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
408-35-5 |
| Unlabeled Synonyms |
Sodium palmitate |
Please kindly note that our products and services are for research use only.
