Sodium dl-3-hydroxybutyrate (3,4,4,4-D4)
| Catalog Number |
ACM1219804688 |
| CAS |
1219804-68-8 |
| Structure |
 |
| Synonyms |
3,4,4,4-Tetradeuterio-3-hydroxybutanoate; Rac 3-Hydroxybutyric acid-D4 sodium salt |
| IUPAC Name |
sodium;3,4,4,4-tetradeuterio-3-hydroxybutanoate |
| Molecular Weight |
130.11 |
| Molecular Formula |
C4H3D4O3Na |
| InChI |
NBPUSGBJDWCHKC-GRONTCIHSA-M |
| InChI Key |
NBPUSGBJDWCHKC-GRONTCIHSA-M |
| Purity |
95% |
| Appearance |
Colourless liquid |
| Chemical Formula |
C4H3D4O3Na |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])(CC(=O)[O-])O.[Na+] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
150-83-4 |
Please kindly note that our products and services are for research use only.
