| Catalog Number |
ACM87081581-1 |
| CAS |
87081-58-1 |
| Structure |
 |
| Synonyms |
Sodium bicarbonate-13C |
| Molecular Weight |
85.00 |
| Molecular Formula |
13CO3NaH |
| InChI |
InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1/i1+1; |
| InChI Key |
UIIMBOGNXHQVGW-YTBWXGASSA-M |
| Melting Point |
300 °C (572 °F) |
| Purity |
98% |
| Density |
2.16 g/cm3 |
| Solubility |
Water: 50 g/L |
| Appearance |
Powder |
| Chemical Formula |
NaH*CO3 |
| Isomeric SMILES |
[13C](=O)(O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
144-55-8 |
| Unlabeled Synonyms |
Sodium hydrogencarbonate |
Please kindly note that our products and services are for research use only.
