| Catalog Number |
ACM111399601-1 |
| CAS |
111399-60-1 |
| Structure |
 |
| Description |
Skatole-d3 is deuterium labeled skatole. Skatole, also known as 3-methylindole, has a molecular formula of C9H9N and has a fecal odor. Skatole can be used as a biochemical reagent and in the preparation of spices. |
| Synonyms |
3-Methylindole-d3; 3-Methyl-1H-indole-d3 |
| Molecular Weight |
134.19 |
| Molecular Formula |
C9H6D3N |
| Canonical SMILES |
[2H]C(C1=CNC2=C1C=CC=C2)([2H])[2H] |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
