Secbumeton D5 100 µg/mL in Acetone
| Catalog Number |
ACM1705649531 |
| CAS |
1705649-53-1 |
| Structure |
 |
| Synonyms |
Secbumeton D5 (N-ethyl D5) |
| IUPAC Name |
4-N-butan-2-yl-6-methoxy-2-N-(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
230.32 |
| Molecular Formula |
C10D5H14N5O |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])Nc1nc(NC(C)CC)nc(OC)n1 |
| InChI |
InChI=1S/C10H19N5O/c1-5-7(3)12-9-13-8(11-6-2)14-10(15-9)16-4/h7H,5-6H2,1-4H3,(H2,11,12,13,14,15)/i2D3,6D2 |
| Storage |
+20 °C |
| Accurate Mass |
230.1903 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
