| Catalog Number |
ACM1219409069 |
| CAS |
1219409-06-9 |
| Structure |
 |
| Synonyms |
a-[(4-Chlorobenzoyl-d4)-amino]-1,2-dihydro-2-oxo-4-quinolinepropanoic Acid, OPC-12759-d4, Mucosta-d4, Proamipide-d4 |
| Molecular Weight |
374.81 |
| Molecular Formula |
C19H11D4ClN2O4 |
| Canonical SMILES |
O=C1NC2=CC=CC=C2C(CC(C(O)=O)NC(C3=C([2H])C([2H])=C(Cl)C([2H])=C3[2H])=O)=C1 |
| Storage |
-20 °C |
| API Family |
Rebamipide |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
90098-04-7 |
Please kindly note that our products and services are for research use only.
