Quizalofop-ethyl D3 (3,3,3 D3) 100 µg/mL in Acetone
| Catalog Number |
ACM1398065843-1 |
| CAS |
1398065-84-3 |
| Structure |
 |
| IUPAC Name |
ethyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3,3,3-trideuteriopropanoate |
| Molecular Weight |
375.82 |
| Molecular Formula |
C19D3H14ClN2O4 |
| Canonical SMILES |
[2H]C([2H])([2H])C(Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)OCC |
| InChI |
InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3/i2D3 |
| Storage |
+20 °C |
| Accurate Mass |
375.1065 |
| Alternative CAS |
76578-14-8 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
