| Catalog Number |
ACM1718521-2 |
| CAS |
1718-52-1 |
| Structure |
 |
| Description |
Pyrene-d10 is the deuterium labeled Pyrene. Pyrene is mainly found in the distillate of coal tar pitch. Pyrene is a raw material for organic synthesis. It can be oxidized to produce 1,4,5,8-naphthalenetetracarboxylic acid, which is used in dyes, synthetic resins, disperse dyes and engineering plastics. After acylation, it can be used to produce the vat dye Brilliant Orange GR and many other products. kind of dye. It can also be used to produce pesticides, plasticizers, etc. |
| Synonyms |
1,2,3,4,5,6,7,8,9,10-decadeuteriopyrene |
| IUPAC Name |
1,2,3,4,5,6,7,8,9,10-decadeuteriopyrene |
| Molecular Weight |
212.31 |
| Molecular Formula |
C16D10 |
| Canonical SMILES |
[2H]C1=C([2H])C([2H])=C2C([2H])=C([2H])C3=C([2H])C([2H])=C([2H])C4=C([2H])C([2H])=C1C2=C43 |
| InChI |
InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChI Key |
BBEAQIROQSPTKN-LHNTUAQVSA-N |
| Melting Point |
145-148 °C (lit.) |
| Appearance |
Yellow to orange solid |
| Storage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Isomeric SMILES |
[2H]C1=C(C2=C3C(=C1[2H])C(=C(C4=C(C(=C(C(=C43)C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
212.1410 |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Unlabeled CAS |
129-00-0 |
