| Catalog Number |
ACM342610995 |
| CAS |
342610-99-5 |
| Structure |
 |
| Synonyms |
PROPIO-D5-PHENONE |
| IUPAC Name |
2,2,3,3,3-pentadeuterio-1-phenylpropan-1-one |
| Molecular Weight |
139.21 |
| Molecular Formula |
C9H5D5O |
| InChI |
InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3/i1D3,2D2 |
| InChI Key |
KRIOVPPHQSLHCZ-ZBJDZAJPSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6H5COCD2CD3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C(=O)C1=CC=CC=C1 |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
93-55-0 |
| Unlabeled Synonyms |
1-Phenyl-1-propanone |
