| Catalog Number |
ACM52910802-2 |
| CAS |
52910-80-2 |
| Structure |
 |
| Description |
(±)-1,2-propanediol-d6 is deuterium-labeled (±)-1,2-propanediol. (±)-1,2-propanediol is used during drug synthesis to increase the solubility and stability of drugs. |
| Synonyms |
1,2-(RS)-Propanediol-d6; 1,2-Propylene glycol-d6; Propylene glycol-d6 |
| Molecular Weight |
82.13 |
| Molecular Formula |
C3H2D6O2 |
| Canonical SMILES |
OC([2H])([2H])C(O)([2H])C([2H])([2H])[2H] |
| Purity |
≥99.0% |
| Appearance |
Liquid |
| Storage |
Pure form: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
