Propafenone-d5 Hydrochloride
| Catalog Number |
ACM93909489 |
| CAS |
93909-48-9 |
| Structure |
 |
| Synonyms |
1-[2-[2-Hydroxy-3-(propylamino)propoxy]phenyl]-3-phenyl-d5-1-propanone Hydrochloride, 2'-[2-Hydroxy-3-(propylamino)propoxy]-3-phenyl-d5-propiophenone Hydrochloride, Arythmol-d5, Pronon-d5, Rythmol-d5, Rytmonorm-d5 |
| Molecular Weight |
382.94 |
| Molecular Formula |
C21H23D5ClNO3 |
| Canonical SMILES |
O=C(CCC1=C([2H])C([2H])=C([2H])C([2H])=C1[2H])C2=C(OCC(O)CNCCC)C=CC=C2.Cl |
| Storage |
-20 °C |
| API Family |
Propafenone Hydrochloride |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
34183-22-7 |
Please kindly note that our products and services are for research use only.
