Propachlor D5 (phenyl D5) 100 µg/mL in Acetone
| Catalog Number |
ACM2732834954 |
| CAS |
2732834-95-4 |
| Structure |
 |
| Synonyms |
Propachlor D5 (phenyl D5) |
| IUPAC Name |
2-chloro-N-(2,3,4,5,6-pentadeuteriophenyl)-N-propan-2-ylacetamide |
| Molecular Weight |
216.72 |
| Molecular Formula |
C11D5H9ClNO |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(N(C(C)C)C(=O)CCl)c([2H])c1[2H] |
| InChI |
InChI=1S/C11H14ClNO/c1-9(2)13(11(14)8-12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3/i3D,4D,5D,6D,7D |
| Storage |
+20 °C |
| Accurate Mass |
216.1078 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
