| Catalog Number |
ACM15775743-1 |
| CAS |
15775-74-3 |
| Structure |
 |
| Synonyms |
Progesterone-D9 |
| IUPAC Name |
(8S,9S,10R,13S,14S,17S)-2,2,4,6,6,17-hexadeuterio-10,13-dimethyl-17-(2,2,2-trideuterioacetyl)-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| Molecular Weight |
323.52 |
| Molecular Formula |
C21H21D9O2 |
| InChI |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1/i1D3,4D2,8D2,12D,17D |
| InChI Key |
RJKFOVLPORLFTN-PQIPVKAESA-N |
| Melting Point |
128-132 °C |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3CC2([2H])[2H])CC[C@]4([2H])C(=O)C([2H])([2H])[2H])C)C |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-83-0 |
| Unlabeled Synonyms |
4-Pregnene-3,20-dione |
