| Catalog Number |
ACM1217769044 |
| CAS |
1217769-04-4 |
| Structure |
 |
| Synonyms |
(2S)-2-(Methyl-d3)butanoic Acid (1S,3S,7S,8S,8aR)-1,2,3,7,8,8a-Hexahydro-3-hydroxy-7-methyl-8-[2-[(2R,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl]ethyl]-1-naphthalenyl Ester |
| IUPAC Name |
[(1S,3S,7S,8S,8aR)-3-hydroxy-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-(trideuteriomethyl)butanoate |
| Molecular Weight |
409.54 |
| Molecular Formula |
C23H31D3O6 |
| Canonical SMILES |
[2H]C([2H])([2H])[C@@H](CC)C(=O)O[C@H]1C[C@@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)O |
| InChI |
1S/C23H34O6/c1-4-13(2)23(27)29-20-11-16(24)9-15-6-5-14(3)19(22(15)20)8-7-18-10-17(25)12-21(26)28-18/h5-6,9,13-14,16-20,22,24-25H,4,7-8,10-12H2,1-3H3/t13-,14-,16+,17+,18+,19-,20-,22-/m0/s1/i2D3 |
| InChI Key |
OQARDMYXSOFTLN-BGFMQMSKSA-N |
| Melting Point |
138-140° C |
| Solubility |
Soluble in Methanol |
| Appearance |
Solid |
| Application |
Pravastatin Lactone-D3 is primarily utilized as an internal standard in analytical chemistry for quantifying the concentration of pravastatin in various samples through techniques such as mass spectrometry. This deuterated compound provides a methodological advantage due to its similar physicochemical properties to non-deuterated pravastatin while being distinguishable based on its mass difference. |
| Storage |
Keep container closed when no tin use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances |
| Type |
Labeled Reference Standards |
