| Catalog Number |
ACM1127253024 |
| CAS |
1127253-02-4 |
| Description |
Prasugrel-d3 is a deuterium labeled Prasugrel. Prasugrel can be used to treat cardiovascular and cerebrovascular diseases such as heart failure, stroke, and unstable angina. |
| Synonyms |
PCR 4099-d3 |
| Molecular Weight |
376.46 |
| Molecular Formula |
C20H17D3FNO3S |
| Canonical SMILES |
O=C(OC(S1)=CC2=C1CCN(C(C3=CC=CC=C3F)C(C4CC4)=O)C2)C([2H])([2H])[2H] |
| Purity |
0.9858 |
| Appearance |
Solid |
| Storage |
Powder: -20℃, 3 years; 4℃, 2 years. In solvent: -80℃, 6 months; -20℃, 1 month. |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
