| Catalog Number |
ACM352438870 |
| CAS |
352438-87-0 |
| Structure |
 |
| Synonyms |
POTASSIUM TETRADECANOATE-D27 |
| IUPAC Name |
potassium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosadeuteriotetradecanoate |
| Molecular Weight |
293.62 |
| Molecular Formula |
C14D27KO2 |
| Canonical SMILES |
CCCCCCCCCCCCCC(=O)[O-].[K+] |
| InChI |
InChI=1S/C14H28O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;/h2-13H2,1H3,(H,15,16);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2; |
| InChI Key |
PYJBVGYZXWPIKK-GGGIBXBISA-M |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)12COOK |
| Exact Mass |
293.33400 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[K+] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
13429-27-1 |
| Unlabeled Synonyms |
Potassium myristate |
