Potassium palmitate (1-13C)
| Catalog Number |
ACM201612580-1 |
| CAS |
201612-58-0 |
| Structure |
 |
| Synonyms |
Potassium palmitate-1-13C |
| IUPAC Name |
potassium;(1-13C)hexadecanoate |
| Molecular Weight |
295.51 |
| Molecular Formula |
13CC15H31KO2 |
| InChI |
InChI=1S/C16H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i16+1; |
| InChI Key |
MQOCIYICOGDBSG-OMVBPHMTSA-M |
| Melting Point |
285 °C (545 °F) (dec.) |
| Purity |
98% |
| Appearance |
Solid |
| Chemical Formula |
CH3(CH2)14*COOK |
| Isomeric SMILES |
CCCCCCCCCCCCCCC[13C](=O)[O-].[K+] |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
2624-31-9 |
Please kindly note that our products and services are for research use only.
