Potassium octadecanoate-2,2-d2
| Catalog Number |
ACM352438869 |
| CAS |
352438-86-9 |
| Structure |
 |
| Synonyms |
Potassium;2,2-dideuteriooctadecanoate |
| IUPAC Name |
potassium;2,2-dideuteriooctadecanoate |
| Molecular Weight |
324.58 |
| Molecular Formula |
C18H33D2KO2 |
| InChI |
InChI=1S/C18H36O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+1/p-1/i17D2; |
| InChI Key |
ANBFRLKBEIFNQU-LDSOZFSUSA-M |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)15CD2COOK |
| Exact Mass |
324.23996533 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCCCCC)C(=O)[O-].[K+] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
324.23996533 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
593-29-3 |
| Unlabeled Synonyms |
Potassium stearate |
Please kindly note that our products and services are for research use only.
