| Catalog Number |
ACM63074475 |
| CAS |
63074-47-5 |
| Structure |
 |
| Synonyms |
Potassium palmitate-D31 |
| IUPAC Name |
potassium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontadeuteriohexadecanoate |
| Molecular Weight |
325.70 |
| Molecular Formula |
C16D31KO2 |
| InChI |
InChI=1S/C16H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2; |
| InChI Key |
MQOCIYICOGDBSG-HXKBIXQXSA-M |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)14COOK |
| EC Number |
694-060-0 |
| Exact Mass |
325.39069084 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[K+] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
325.39069084 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
2624-31-9 |
| Unlabeled Synonyms |
Potassium palmitate |
