Potassium hexadecanoate-2,2-d2
| Catalog Number |
ACM203805861 |
| CAS |
203805-86-1 |
| Structure |
 |
| Synonyms |
Palmitic acid-2,2-D2 potassium salt |
| IUPAC Name |
potassium;2,2-dideuteriohexadecanoate |
| Molecular Weight |
296.52 |
| Molecular Formula |
C16H29D2KO2 |
| InChI |
InChI=1S/C16H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i15D2; |
| InChI Key |
MQOCIYICOGDBSG-BMIYEHQMSA-M |
| Melting Point |
285 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)13CD2COOK |
| EC Number |
686-088-7 |
| Exact Mass |
296.20866520 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCCCC)C(=O)[O-].[K+] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
296.20866520 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
2624-31-9 |
| Unlabeled Synonyms |
Potassium palmitate |
Please kindly note that our products and services are for research use only.
