Phthalic acid, bis-phenyl ester D4
| Catalog Number |
ACM1398065616-1 |
| CAS |
1398065-61-6 |
| Structure |
 |
| Synonyms |
1,2-Benzenedicarboxylic acid-3,4,5,6-d4, 1,2-diphenyl ester |
| IUPAC Name |
diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
322.35 |
| Molecular Formula |
C20D4H10O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)Oc2ccccc2)c(C(=O)Oc3ccccc3)c1[2H] |
| InChI |
InChI=1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H/i7D,8D,13D,14D |
| Storage |
+20 °C |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
