Phthalic acid, bis-2-n-butoxyethyl ester D4
| Catalog Number |
ACM1398065967-2 |
| CAS |
1398065-96-7 |
| Structure |
 |
| IUPAC Name |
bis(2-butoxyethyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
370.47 |
| Molecular Formula |
C20D4H26O6 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCCOCCCC)c(C(=O)OCCOCCCC)c1[2H] |
| InChI |
InChI=1S/C20H30O6/c1-3-5-11-23-13-15-25-19(21)17-9-7-8-10-18(17)20(22)26-16-14-24-12-6-4-2/h7-10H,3-6,11-16H2,1-2H3/i7D,8D,9D,10D |
| Storage |
+20 °C |
| Accurate Mass |
370.2293 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
117-83-9 |
Please kindly note that our products and services are for research use only.
