Phthalic acid, bis-isopropyl ester D4 100 µg/mL in Cyclohexane
| Catalog Number |
ACM2708282442-1 |
| CAS |
2708282-44-2 |
| Structure |
 |
| IUPAC Name |
dipropan-2-yl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
254.32 |
| Molecular Formula |
C14D4H14O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OC(C)C)c(C(=O)OC(C)C)c1[2H] |
| InChI |
InChI=1S/C14H18O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-10H,1-4H3/i5D,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
254.146 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
