Phthalic acid, bis-isopentyl ester D4
| Catalog Number |
ACM1346597805-2 |
| CAS |
1346597-80-5 |
| Structure |
 |
| Synonyms |
Bis(3-methylbutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate, Phthalic acid bis-iso-pentyl ester D4 |
| IUPAC Name |
bis(3-methylbutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
310.42 |
| Molecular Formula |
C18D4H22O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCCC(C)C)c(C(=O)OCCC(C)C)c1[2H] |
| InChI |
InChI=1S/C18H26O4/c1-13(2)9-11-21-17(19)15-7-5-6-8-16(15)18(20)22-12-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3/i5D,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
310.2082 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
605-50-5 |
Please kindly note that our products and services are for research use only.
