Phthalic acid, bis-2-ethylhexyl ester D4 100 µg/mL in Cyclohexane
| Catalog Number |
ACM93951872-2 |
| CAS |
93951-87-2 |
| Structure |
 |
| IUPAC Name |
bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
394.58 |
| Molecular Formula |
C24D4H34O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCC(CC)CCCC)c(C(=O)OCC(CC)CCCC)c1[2H] |
| InChI |
InChI=1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3/i11D,12D,15D,16D |
| Storage |
+20 °C |
| Accurate Mass |
394.3021 |
| Alternative CAS |
117-81-7 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
