Phthalic acid, bis-butyl ester D4
| Catalog Number |
ACM93952115-3 |
| CAS |
93952-11-5 |
| Structure |
 |
| IUPAC Name |
dibutyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Weight |
282.37 |
| Molecular Formula |
C16D4H18O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCCCC)c(C(=O)OCCCC)c1[2H] |
| InChI |
InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3/i7D,8D,9D,10D |
| Storage |
+20 °C |
| Accurate Mass |
282.1769 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
84-74-2 |
Please kindly note that our products and services are for research use only.
