| Catalog Number |
ACM2083623418-1 |
| CAS |
2083623-41-8 |
| Structure |
 |
| Synonyms |
Phosmet D6 (dimethyl D3) |
| IUPAC Name |
2-[bis(trideuteriomethoxy)phosphinothioylsulfanylmethyl]isoindole-1,3-dione |
| Molecular Weight |
323.36 |
| Molecular Formula |
C11D6H6NO4PS2 |
| Canonical SMILES |
[2H]C([2H])([2H])OP(=S)(OC([2H])([2H])[2H])SCN1C(=O)c2ccccc2C1=O |
| InChI |
InChI=1S/C11H12NO4PS2/c1-15-17(18,16-2)19-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,7H2,1-2H3/i1D3,2D3 |
| Storage |
-18 °C |
| Accurate Mass |
323.0322 |
| Alternative CAS |
732-11-6 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
